C16H17N5O2 — CID 50748908
11-[(3-methoxyanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 50748908) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 11-[(3-methoxyanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 11-[(3-methoxyanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 50748908 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 11-[(3-methoxyanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | COc1cccc(NCc2nc3nc4c(c(=O)n3[nH]2)CCC4)c1 |
| InChI | InChI=1S/C16H17N5O2/c1-23-11-5-2-4-10(8-11)17-9-14-19-16-18-13-7-3-6-12(13)15(22)21(16)20-14/h2,4-5,8,17H,3,6-7,9H2,1H3,(H,18,19,20) |
| InChIKey | HPFOGUTXCHKBPF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |