C16H15N5O2 — CID 6461169
N-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)-2-phenylacetamide (PubChem CID 6461169) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)-2-phenylacetamide.
| Compound Name | N-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 6461169 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(2-oxo-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-11-yl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nc2nc3c(c(=O)n2[nH]1)CCC3 |
| InChI | InChI=1S/C16H15N5O2/c22-13(9-10-5-2-1-3-6-10)18-15-19-16-17-12-8-4-7-11(12)14(23)21(16)20-15/h1-3,5-6H,4,7-9H2,(H2,17,18,19,20,22) |
| InChIKey | PJALJTDRPHFSDI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |