C16H16ClN5O — CID 50748770
11-[(3-chloro-2-methylanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 50748770) has the molecular formula C16H16ClN5O and a molecular weight of 329.79 g/mol. Its IUPAC name is 11-[(3-chloro-2-methylanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 11-[(3-chloro-2-methylanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 50748770 |
| Molecular Formula | C16H16ClN5O |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 11-[(3-chloro-2-methylanilino)methyl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | Cc1c(Cl)cccc1NCc1nc2nc3c(c(=O)n2[nH]1)CCC3 |
| InChI | InChI=1S/C16H16ClN5O/c1-9-11(17)5-3-6-12(9)18-8-14-20-16-19-13-7-2-4-10(13)15(23)22(16)21-14/h3,5-6,18H,2,4,7-8H2,1H3,(H,19,20,21) |
| InChIKey | IMZXVDSNMIJWAM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |