C14H15N5OS — CID 23610717
2-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-9-one (PubChem CID 23610717) has the molecular formula C14H15N5OS and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-9-one.
| Compound Name | 2-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 23610717 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(thiophen-2-ylmethylamino)-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-9-one |
| SMILES | O=c1c2c(nc3nc(NCc4cccs4)[nH]n13)CCCC2 |
| InChI | InChI=1S/C14H15N5OS/c20-12-10-5-1-2-6-11(10)16-14-17-13(18-19(12)14)15-8-9-4-3-7-21-9/h3-4,7H,1-2,5-6,8H2,(H2,15,16,17,18) |
| InChIKey | MSTYUXVIWHMOQY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |