C27H19N3O2S2 — CID 135635225
(5E)-3-benzyl-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 135635225) has the molecular formula C27H19N3O2S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135635225 |
| Molecular Formula | C27H19N3O2S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (5E)-3-benzyl-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cc(/N=N/c3cccc4ccccc34)ccc2O)SC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H19N3O2S2/c31-24-14-13-21(28-29-23-12-6-10-19-9-4-5-11-22(19)23)15-20(24)16-25-26(32)30(27(33)34-25)17-18-7-2-1-3-8-18/h1-16,31H,17H2/b25-16+,29-28+ |
| InChIKey | BHWGJBZFEWPTIQ-IDEODVPUSA-N |
| XLogP | 7.36 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|