C29H23N3O5S — CID 135968467
(5Z)-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-3-[2-(2-methoxyphenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 135968467) has the molecular formula C29H23N3O5S and a molecular weight of 525.59 g/mol. Its IUPAC name is (5Z)-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-3-[2-(2-methoxyphenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-3-[2-(2-methoxyphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 135968467 |
| Molecular Formula | C29H23N3O5S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (5Z)-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-3-[2-(2-methoxyphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccccc1OCCN1C(=O)S/C(=C\c2cc(/N=N/c3cccc4ccccc34)ccc2O)C1=O |
| InChI | InChI=1S/C29H23N3O5S/c1-36-25-11-4-5-12-26(25)37-16-15-32-28(34)27(38-29(32)35)18-20-17-21(13-14-24(20)33)30-31-23-10-6-8-19-7-2-3-9-22(19)23/h2-14,17-18,33H,15-16H2,1H3/b27-18-,31-30+ |
| InChIKey | MDGGMNNTZOKMTD-BDJRAXNJSA-N |
| XLogP | 7.08 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|