C28H20ClN3O4S — CID 135968397
(5Z)-3-[2-(2-chlorophenoxy)ethyl]-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 135968397) has the molecular formula C28H20ClN3O4S and a molecular weight of 530.01 g/mol. Its IUPAC name is (5Z)-3-[2-(2-chlorophenoxy)ethyl]-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(2-chlorophenoxy)ethyl]-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 135968397 |
| Molecular Formula | C28H20ClN3O4S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | (5Z)-3-[2-(2-chlorophenoxy)ethyl]-5-[[2-hydroxy-5-(naphthalen-1-yldiazenyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cc(/N=N/c3cccc4ccccc34)ccc2O)C(=O)N1CCOc1ccccc1Cl |
| InChI | InChI=1S/C28H20ClN3O4S/c29-22-9-3-4-11-25(22)36-15-14-32-27(34)26(37-28(32)35)17-19-16-20(12-13-24(19)33)30-31-23-10-5-7-18-6-1-2-8-21(18)23/h1-13,16-17,33H,14-15H2/b26-17-,31-30+ |
| InChIKey | NYFSJMJBIIGISK-XKMUICFYSA-N |
| XLogP | 7.73 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|