C25H21N3O4S — CID 135968369
(5Z)-5-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]-3-[2-(3-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 135968369) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is (5Z)-5-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]-3-[2-(3-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]-3-[2-(3-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 135968369 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (5Z)-5-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]-3-[2-(3-methylphenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cccc(OCCN2C(=O)S/C(=C\c3cc(/N=N/c4ccccc4)ccc3O)C2=O)c1 |
| InChI | InChI=1S/C25H21N3O4S/c1-17-6-5-9-21(14-17)32-13-12-28-24(30)23(33-25(28)31)16-18-15-20(10-11-22(18)29)27-26-19-7-3-2-4-8-19/h2-11,14-16,29H,12-13H2,1H3/b23-16-,27-26+ |
| InChIKey | RZDGRQWCTOGINA-MAELQIJGSA-N |
| XLogP | 6.23 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|