C19H17N3O2S2 — CID 137059868
(5Z)-5-[[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 137059868) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (5Z)-5-[[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137059868 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (5Z)-5-[[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=N/c2ccc(O)c(/C=C3\SC(=S)N(C)C3=O)c2)cc1C |
| InChI | InChI=1S/C19H17N3O2S2/c1-11-4-5-14(8-12(11)2)20-21-15-6-7-16(23)13(9-15)10-17-18(24)22(3)19(25)26-17/h4-10,23H,1-3H3/b17-10-,21-20+ |
| InChIKey | RTVVDVBDJHWGHX-KQHCDTJNSA-N |
| XLogP | 5.26 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|