C23H27N3O2S — CID 135636574
9-(4-octoxyphenyl)-8,9-dihydro-6H-[1,2,5]thiadiazolo[3,4-f]quinolin-7-one (PubChem CID 135636574) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 9-(4-octoxyphenyl)-8,9-dihydro-6H-[1,2,5]thiadiazolo[3,4-f]quinolin-7-one.
| Compound Name | 9-(4-octoxyphenyl)-8,9-dihydro-6H-[1,2,5]thiadiazolo[3,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 135636574 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 9-(4-octoxyphenyl)-8,9-dihydro-6H-[1,2,5]thiadiazolo[3,4-f]quinolin-7-one |
| SMILES | CCCCCCCCOc1ccc(C2CC(=O)Nc3ccc4nsnc4c32)cc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-2-3-4-5-6-7-14-28-17-10-8-16(9-11-17)18-15-21(27)24-19-12-13-20-23(22(18)19)26-29-25-20/h8-13,18H,2-7,14-15H2,1H3,(H,24,27) |
| InChIKey | XIGNXBIZODINNE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|