C16H15N7O5 — CID 135637234
3-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-8-N-methyl-4-oxo-1H-imidazo[5,1-c][1,2,4]triazine-3,8-dicarboxamide (PubChem CID 135637234) has the molecular formula C16H15N7O5 and a molecular weight of 385.34 g/mol. Its IUPAC name is 3-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-8-N-methyl-4-oxo-1H-imidazo[5,1-c][1,2,4]triazine-3,8-dicarboxamide.
| Compound Name | 3-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-8-N-methyl-4-oxo-1H-imidazo[5,1-c][1,2,4]triazine-3,8-dicarboxamide |
|---|---|
| PubChem CID | 135637234 |
| Molecular Formula | C16H15N7O5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-8-N-methyl-4-oxo-1H-imidazo[5,1-c][1,2,4]triazine-3,8-dicarboxamide |
| SMILES | CNC(=O)c1ncn2c(=O)c(C(=O)N/N=C/c3ccc(O)c(OC)c3)n[nH]c12 |
| InChI | InChI=1S/C16H15N7O5/c1-17-14(25)11-13-21-20-12(16(27)23(13)7-18-11)15(26)22-19-6-8-3-4-9(24)10(5-8)28-2/h3-7,21,24H,1-2H3,(H,17,25)(H,22,26)/b19-6+ |
| InChIKey | ZXXNUPLYFATRNH-KPSZGOFPSA-N |
| XLogP | -0.74 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|