C20H19N5O3 — CID 135637295
N-methyl-1-[(E)-(4-methylphenyl)methylideneamino]-5-oxo-3-phenacyl-2H-triazol-3-ium-4-carboximidate (PubChem CID 135637295) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-methyl-1-[(E)-(4-methylphenyl)methylideneamino]-5-oxo-3-phenacyl-2H-triazol-3-ium-4-carboximidate.
| Compound Name | N-methyl-1-[(E)-(4-methylphenyl)methylideneamino]-5-oxo-3-phenacyl-2H-triazol-3-ium-4-carboximidate |
|---|---|
| PubChem CID | 135637295 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-methyl-1-[(E)-(4-methylphenyl)methylideneamino]-5-oxo-3-phenacyl-2H-triazol-3-ium-4-carboximidate |
| SMILES | C/N=C(\[O-])c1c(=O)n(/N=C/c2ccc(C)cc2)[nH][n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N5O3/c1-14-8-10-15(11-9-14)12-22-25-20(28)18(19(27)21-2)24(23-25)13-17(26)16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H-,21,23,27,28)/b22-12+ |
| InChIKey | OQYQZPNTSCRESN-WSDLNYQXSA-N |
| XLogP | 0.27 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|