C12H13FN5O2+ — CID 53400038
1-[(4-fluorophenyl)methylideneamino]-N,3-dimethyl-5-oxo-2H-triazol-3-ium-4-carboxamide (PubChem CID 53400038) has the molecular formula C12H13FN5O2+ and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methylideneamino]-N,3-dimethyl-5-oxo-2H-triazol-3-ium-4-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methylideneamino]-N,3-dimethyl-5-oxo-2H-triazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 53400038 |
| Molecular Formula | C12H13FN5O2+ |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-[(4-fluorophenyl)methylideneamino]-N,3-dimethyl-5-oxo-2H-triazol-3-ium-4-carboxamide |
| SMILES | CNC(=O)c1c(=O)n(N=Cc2ccc(F)cc2)[nH][n+]1C |
| InChI | InChI=1S/C12H12FN5O2/c1-14-11(19)10-12(20)18(16-17(10)2)15-7-8-3-5-9(13)6-4-8/h3-7H,1-2H3,(H-,14,16,19,20)/p+1 |
| InChIKey | KAEBNUKGXHXWMD-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|