C18H17ClN5O2+ — CID 92919170
3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-N-methyl-5-oxo-2H-triazol-3-ium-4-carboxamide (PubChem CID 92919170) has the molecular formula C18H17ClN5O2+ and a molecular weight of 370.82 g/mol. Its IUPAC name is 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-N-methyl-5-oxo-2H-triazol-3-ium-4-carboxamide.
| Compound Name | 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-N-methyl-5-oxo-2H-triazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 92919170 |
| Molecular Formula | C18H17ClN5O2+ |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-N-methyl-5-oxo-2H-triazol-3-ium-4-carboxamide |
| SMILES | CNC(=O)c1c(=O)n(/N=C\c2ccc(Cl)cc2)[nH][n+]1Cc1ccccc1 |
| InChI | InChI=1S/C18H16ClN5O2/c1-20-17(25)16-18(26)24(21-11-13-7-9-15(19)10-8-13)22-23(16)12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H-,20,22,25,26)/p+1/b21-11- |
| InChIKey | HJTKQXMDYPAIRR-NHDPSOOVSA-O |
| XLogP | 1.41 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|