C17H14ClN5O2 — CID 92917003
N-benzyl-1-[(E)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazole-4-carboxamide (PubChem CID 92917003) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is N-benzyl-1-[(E)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[(E)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 92917003 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-benzyl-1-[(E)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1n[nH]n(/N=C/c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C17H14ClN5O2/c18-14-8-6-13(7-9-14)11-20-23-17(25)15(21-22-23)16(24)19-10-12-4-2-1-3-5-12/h1-9,11,22H,10H2,(H,19,24)/b20-11+ |
| InChIKey | UFGDLODELBCTOI-RGVLZGJSSA-N |
| XLogP | 2.04 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|