C17H14FN5O2 — CID 1499744
1-(benzylideneamino)-N-[(4-fluorophenyl)methyl]-5-oxo-2H-triazole-4-carboxamide (PubChem CID 1499744) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is 1-(benzylideneamino)-N-[(4-fluorophenyl)methyl]-5-oxo-2H-triazole-4-carboxamide.
| Compound Name | 1-(benzylideneamino)-N-[(4-fluorophenyl)methyl]-5-oxo-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 1499744 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-(benzylideneamino)-N-[(4-fluorophenyl)methyl]-5-oxo-2H-triazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1n[nH]n(N=Cc2ccccc2)c1=O |
| InChI | InChI=1S/C17H14FN5O2/c18-14-8-6-13(7-9-14)10-19-16(24)15-17(25)23(22-21-15)20-11-12-4-2-1-3-5-12/h1-9,11,22H,10H2,(H,19,24) |
| InChIKey | VBENIQAOOVDXKC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|