C19H18ClN4O3+ — CID 92919168
ethyl 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazol-3-ium-4-carboxylate (PubChem CID 92919168) has the molecular formula C19H18ClN4O3+ and a molecular weight of 385.83 g/mol. Its IUPAC name is ethyl 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazol-3-ium-4-carboxylate.
| Compound Name | ethyl 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazol-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 92919168 |
| Molecular Formula | C19H18ClN4O3+ |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | ethyl 3-benzyl-1-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-2H-triazol-3-ium-4-carboxylate |
| SMILES | CCOC(=O)c1c(=O)n(/N=C\c2ccc(Cl)cc2)[nH][n+]1Cc1ccccc1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-2-27-19(26)17-18(25)24(21-12-14-8-10-16(20)11-9-14)22-23(17)13-15-6-4-3-5-7-15/h3-12H,2,13H2,1H3/p+1/b21-12- |
| InChIKey | MHLFEYSKYYUNJS-MTJSOVHGSA-O |
| XLogP | 2.22 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|