C29H43NO5 — CID 135639002
3-[(8R,9S,10R,13R)-10-(cyclohexyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 135639002) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is 3-[(8R,9S,10R,13R)-10-(cyclohexyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(8R,9S,10R,13R)-10-(cyclohexyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 135639002 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | 3-[(8R,9S,10R,13R)-10-(cyclohexyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4(O)CC(O)CC[C@]34/C=N/C3CCCCC3)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H43NO5/c1-26-11-8-23-24(29(26,34)14-10-22(26)19-15-25(32)35-17-19)9-13-28(33)16-21(31)7-12-27(23,28)18-30-20-5-3-2-4-6-20/h15,18,20-24,31,33-34H,2-14,16-17H2,1H3/b30-18+/t21?,22?,23-,24+,26+,27-,28?,29?/m0/s1 |
| InChIKey | YLGZIVFTZIXXIM-NXFHZSDHSA-N |
| XLogP | 4.10 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|