C27H41NO7 — CID 44667541
3-[(9S,13R)-10-(2,2-dimethoxyethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 44667541) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is 3-[(9S,13R)-10-(2,2-dimethoxyethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(9S,13R)-10-(2,2-dimethoxyethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 44667541 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 3-[(9S,13R)-10-(2,2-dimethoxyethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | COC(C/N=C/C12CCC(O)CC1(O)CCC1[C@@H]2CC[C@]2(C)C(C3=CC(=O)OC3)CCC12O)OC |
| InChI | InChI=1S/C27H41NO7/c1-24-8-5-20-21(27(24,32)11-7-19(24)17-12-22(30)35-15-17)6-10-26(31)13-18(29)4-9-25(20,26)16-28-14-23(33-2)34-3/h12,16,18-21,23,29,31-32H,4-11,13-15H2,1-3H3/b28-16+/t18?,19?,20-,21?,24+,25?,26?,27?/m0/s1 |
| InChIKey | XWFDREYZNGAQBP-MDCZLNDTSA-N |
| XLogP | 2.39 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|