C28H37NO6 — CID 135639129
3-[(9S,10R,13R)-10-(furan-2-ylmethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 135639129) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[(9S,10R,13R)-10-(furan-2-ylmethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[(9S,10R,13R)-10-(furan-2-ylmethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 135639129 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 3-[(9S,10R,13R)-10-(furan-2-ylmethyliminomethyl)-3,5,14-trihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | C[C@]12CC[C@H]3C(CCC4(O)CC(O)CC[C@]34/C=N/Cc3ccco3)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C28H37NO6/c1-25-8-5-22-23(28(25,33)11-7-21(25)18-13-24(31)35-16-18)6-10-27(32)14-19(30)4-9-26(22,27)17-29-15-20-3-2-12-34-20/h2-3,12-13,17,19,21-23,30,32-33H,4-11,14-16H2,1H3/b29-17+/t19?,21?,22-,23?,25+,26-,27?,28?/m0/s1 |
| InChIKey | WXJZSOITXDMXEE-TZKNTRHOSA-N |
| XLogP | 3.56 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|