C24H25N5O2S — CID 135640922
2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135640922) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135640922 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | CCn1c(COc2ccc3c(c2)CCCC3)nnc1SCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H25N5O2S/c1-2-29-22(14-31-18-12-11-16-7-3-4-8-17(16)13-18)27-28-24(29)32-15-21-25-20-10-6-5-9-19(20)23(30)26-21/h5-6,9-13H,2-4,7-8,14-15H2,1H3,(H,25,26,30) |
| InChIKey | YGIQRUMBHNWYGE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |