C20H23N5O2S2 — CID 2213751
2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2213751) has the molecular formula C20H23N5O2S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2213751 |
| Molecular Formula | C20H23N5O2S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCn1c(COc2ccc3c(c2)CCCC3)nnc1SCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C20H23N5O2S2/c1-2-25-17(12-27-16-8-7-14-5-3-4-6-15(14)11-16)23-24-20(25)29-13-18(26)22-19-21-9-10-28-19/h7-11H,2-6,12-13H2,1H3,(H,21,22,26) |
| InChIKey | QDXOXBNNNAHFHN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |