C21H24N6O2S2 — CID 6498090
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6498090) has the molecular formula C21H24N6O2S2 and a molecular weight of 456.60 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6498090 |
| Molecular Formula | C21H24N6O2S2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-[[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(COc2ccc3c(c2)CCCC3)nnc1SCC(=O)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C21H24N6O2S2/c1-27-17(11-29-16-9-8-13-4-2-3-5-15(13)10-16)23-26-21(27)30-12-18(28)22-20-25-24-19(31-20)14-6-7-14/h8-10,14H,2-7,11-12H2,1H3,(H,22,25,28) |
| InChIKey | BNZFKWIUORZEMX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |