C21H26N6O2S2 — CID 17019214
2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 17019214) has the molecular formula C21H26N6O2S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17019214 |
| Molecular Formula | C21H26N6O2S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CSc2nnc(COc3ccc4c(c3)CCCC4)n2CC)s1 |
| InChI | InChI=1S/C21H26N6O2S2/c1-3-19-24-25-20(31-19)22-18(28)13-30-21-26-23-17(27(21)4-2)12-29-16-10-9-14-7-5-6-8-15(14)11-16/h9-11H,3-8,12-13H2,1-2H3,(H,22,25,28) |
| InChIKey | WZGZPBKEJKXXGP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |