C21H25N5O2S2 — CID 40990252
(2S)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 40990252) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is (2S)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 40990252 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2S)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CCn1c(COc2ccc3c(c2)CCCC3)nnc1S[C@@H](C)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C21H25N5O2S2/c1-3-26-18(13-28-17-9-8-15-6-4-5-7-16(15)12-17)24-25-21(26)30-14(2)19(27)23-20-22-10-11-29-20/h8-12,14H,3-7,13H2,1-2H3,(H,22,23,27)/t14-/m0/s1 |
| InChIKey | PPMFADZEKPFLIT-AWEZNQCLSA-N |
| XLogP | 4.33 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |