C22H27N5O2S2 — CID 41008078
(2R)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 41008078) has the molecular formula C22H27N5O2S2 and a molecular weight of 457.63 g/mol. Its IUPAC name is (2R)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | (2R)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 41008078 |
| Molecular Formula | C22H27N5O2S2 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2R)-2-[[4-ethyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CCn1c(COc2ccc3c(c2)CCCC3)nnc1S[C@H](C)C(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C22H27N5O2S2/c1-4-27-19(12-29-18-10-9-16-7-5-6-8-17(16)11-18)25-26-22(27)31-15(3)20(28)24-21-23-14(2)13-30-21/h9-11,13,15H,4-8,12H2,1-3H3,(H,23,24,28)/t15-/m1/s1 |
| InChIKey | FIEHPASYEMLGJT-OAHLLOKOSA-N |
| XLogP | 4.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |