C18H24N4O2 — CID 135641223
5-(diethylamino)-2-methanimidoylphenol;N-methylpyridine-4-carboxamide (PubChem CID 135641223) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-(diethylamino)-2-methanimidoylphenol;N-methylpyridine-4-carboxamide.
| Compound Name | 5-(diethylamino)-2-methanimidoylphenol;N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 135641223 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 5-(diethylamino)-2-methanimidoylphenol;N-methylpyridine-4-carboxamide |
| SMILES | CNC(=O)c1ccncc1.[H]/N=C/c1ccc(N(CC)CC)cc1O |
| InChI | InChI=1S/C11H16N2O.C7H8N2O/c1-3-13(4-2)10-6-5-9(8-12)11(14)7-10;1-8-7(10)6-2-4-9-5-3-6/h5-8,12,14H,3-4H2,1-2H3;2-5H,1H3,(H,8,10)/b12-8+; |
| InChIKey | WWADFSUKEDYTTL-MXZHIVQLSA-N |
| XLogP | 2.68 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|