C27H23N5O — CID 135641994
3-(4,5-diphenylimidazol-1-yl)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide (PubChem CID 135641994) has the molecular formula C27H23N5O and a molecular weight of 433.52 g/mol. Its IUPAC name is 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide.
| Compound Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 135641994 |
| Molecular Formula | C27H23N5O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-1H-indol-3-ylmethylideneamino]propanamide |
| SMILES | O=C(CCn1cnc(-c2ccccc2)c1-c1ccccc1)N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H23N5O/c33-25(31-30-18-22-17-28-24-14-8-7-13-23(22)24)15-16-32-19-29-26(20-9-3-1-4-10-20)27(32)21-11-5-2-6-12-21/h1-14,17-19,28H,15-16H2,(H,31,33)/b30-18+ |
| InChIKey | OYVMZSMTYXIIIF-UXHLAJHPSA-N |
| XLogP | 5.24 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|