C26H24N4O2 — CID 35583303
3-(4,5-diphenylimidazol-1-yl)-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide (PubChem CID 35583303) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-(4,5-diphenylimidazol-1-yl)-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 35583303 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(Z)-(3-methoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cccc(/C=N\NC(=O)CCn2cnc(-c3ccccc3)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N4O2/c1-32-23-14-8-9-20(17-23)18-28-29-24(31)15-16-30-19-27-25(21-10-4-2-5-11-21)26(30)22-12-6-3-7-13-22/h2-14,17-19H,15-16H2,1H3,(H,29,31)/b28-18- |
| InChIKey | GJLRVTHKDUKWRX-VEILYXNESA-N |
| XLogP | 4.77 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|