C33H38N4O2 — CID 17028298
3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(4-octoxyphenyl)methylideneamino]propanamide (PubChem CID 17028298) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(4-octoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(4-octoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 17028298 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 3-(4,5-diphenylimidazol-1-yl)-N-[(E)-(4-octoxyphenyl)methylideneamino]propanamide |
| SMILES | CCCCCCCCOc1ccc(/C=N/NC(=O)CCn2cnc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H38N4O2/c1-2-3-4-5-6-13-24-39-30-20-18-27(19-21-30)25-35-36-31(38)22-23-37-26-34-32(28-14-9-7-10-15-28)33(37)29-16-11-8-12-17-29/h7-12,14-21,25-26H,2-6,13,22-24H2,1H3,(H,36,38)/b35-25+ |
| InChIKey | LCWFGGRGPCAWET-KVQDIILNSA-N |
| XLogP | 7.50 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|