C21H24Br2N2O4 — CID 135644774
2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135644774) has the molecular formula C21H24Br2N2O4 and a molecular weight of 528.24 g/mol. Its IUPAC name is 2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135644774 |
| Molecular Formula | C21H24Br2N2O4 |
| Molecular Weight | 528.24 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | 2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2c(C(C)C)cc(Br)c(C)c2Br)ccc1O |
| InChI | InChI=1S/C21H24Br2N2O4/c1-5-28-18-8-14(6-7-17(18)26)10-24-25-19(27)11-29-21-15(12(2)3)9-16(22)13(4)20(21)23/h6-10,12,26H,5,11H2,1-4H3,(H,25,27)/b24-10+ |
| InChIKey | PSXJLOLKYJRMLM-YSURURNPSA-N |
| XLogP | 5.28 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.24 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|