C21H21Br2N2O5- — CID 4615385
2-[2-[[[2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 4615385) has the molecular formula C21H21Br2N2O5- and a molecular weight of 541.22 g/mol. Its IUPAC name is 2-[2-[[[2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[[[2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4615385 |
| Molecular Formula | C21H21Br2N2O5- |
| Molecular Weight | 541.22 g/mol |
| Exact Mass | 538.98 |
| IUPAC Name | 2-[2-[[[2-(2,4-dibromo-3-methyl-6-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1c(Br)cc(C(C)C)c(OCC(=O)NN=Cc2ccccc2OCC(=O)[O-])c1Br |
| InChI | InChI=1S/C21H22Br2N2O5/c1-12(2)15-8-16(22)13(3)20(23)21(15)30-10-18(26)25-24-9-14-6-4-5-7-17(14)29-11-19(27)28/h4-9,12H,10-11H2,1-3H3,(H,25,26)(H,27,28)/p-1 |
| InChIKey | GXRYGSUAAAZQAG-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|