C20H16ClN5O2S — CID 135645448
N-(3-chloro-2-methylphenyl)-2-[(6-oxo-9-phenyl-1H-purin-8-yl)sulfanyl]acetamide (PubChem CID 135645448) has the molecular formula C20H16ClN5O2S and a molecular weight of 425.90 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[(6-oxo-9-phenyl-1H-purin-8-yl)sulfanyl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[(6-oxo-9-phenyl-1H-purin-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135645448 |
| Molecular Formula | C20H16ClN5O2S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[(6-oxo-9-phenyl-1H-purin-8-yl)sulfanyl]acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1nc2c(=O)[nH]cnc2n1-c1ccccc1 |
| InChI | InChI=1S/C20H16ClN5O2S/c1-12-14(21)8-5-9-15(12)24-16(27)10-29-20-25-17-18(22-11-23-19(17)28)26(20)13-6-3-2-4-7-13/h2-9,11H,10H2,1H3,(H,24,27)(H,22,23,28) |
| InChIKey | NPYDCBSFJPVZAO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |