C22H19N5O4S — CID 135648014
methyl 2-[[2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 135648014) has the molecular formula C22H19N5O4S and a molecular weight of 449.49 g/mol. Its IUPAC name is methyl 2-[[2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135648014 |
| Molecular Formula | C22H19N5O4S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | methyl 2-[[2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1nc2c(=O)[nH]cnc2n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H19N5O4S/c1-13-7-9-14(10-8-13)27-19-18(20(29)24-12-23-19)26-22(27)32-11-17(28)25-16-6-4-3-5-15(16)21(30)31-2/h3-10,12H,11H2,1-2H3,(H,25,28)(H,23,24,29) |
| InChIKey | BYODDSCRDVIWDV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |