C22H21N5O3S — CID 135648034
N-(4-ethoxyphenyl)-2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetamide (PubChem CID 135648034) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135648034 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[9-(4-methylphenyl)-6-oxo-1H-purin-8-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3c(=O)[nH]cnc3n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H21N5O3S/c1-3-30-17-10-6-15(7-11-17)25-18(28)12-31-22-26-19-20(23-13-24-21(19)29)27(22)16-8-4-14(2)5-9-16/h4-11,13H,3,12H2,1-2H3,(H,25,28)(H,23,24,29) |
| InChIKey | IWIJIZKGZSRXOW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |