About 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile
4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile (PubChem CID 135646740) has the molecular formula C17H12BrN5
and a molecular weight of 366.22 g/mol. Its IUPAC name is 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile |
| PubChem CID | 135646740 |
| Molecular Formula | C17H12BrN5 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile |
| SMILES | N#CC1=C(N)n2c(nc3ccccc32)NC1c1ccccc1Br |
| InChI | InChI=1S/C17H12BrN5/c18-12-6-2-1-5-10(12)15-11(9-19)16(20)23-14-8-4-3-7-13(14)21-17(23)22-15/h1-8,15H,20H2,(H,21,22) |
| InChIKey | DFZVCFMQYJQWHW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile?
The IUPAC name of 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile (CID 135646740) is 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile.
What is the SMILES notation for 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile?
The canonical SMILES for 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile is N#CC1=C(N)n2c(nc3ccccc32)NC1c1ccccc1Br.
What is the InChIKey of 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile?
The InChIKey is DFZVCFMQYJQWHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrN5/c18-12-6-2-1-5-10(12)15-11(9-19)16(20)23-14-8-4-3-7-13(14)21-17(23)22-15/h1-8,15H,20H2,(H,21,22).
What are the key properties of 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile?
4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile has a molecular weight of 366.22 g/mol, XLogP of 3.62, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(2-bromophenyl)-1,2-dihydropyrimido[1,2-a]benzimidazole-3-carbonitrile is sourced from PubChem (CID 135646740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).