C22H15BrN4O — CID 139214302
2-amino-4-(2-bromophenyl)-6-(1-methylindol-3-yl)-4H-pyran-3,5-dicarbonitrile (PubChem CID 139214302) has the molecular formula C22H15BrN4O and a molecular weight of 431.29 g/mol. Its IUPAC name is 2-amino-4-(2-bromophenyl)-6-(1-methylindol-3-yl)-4H-pyran-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2-bromophenyl)-6-(1-methylindol-3-yl)-4H-pyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 139214302 |
| Molecular Formula | C22H15BrN4O |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-amino-4-(2-bromophenyl)-6-(1-methylindol-3-yl)-4H-pyran-3,5-dicarbonitrile |
| SMILES | Cn1cc(C2=C(C#N)C(c3ccccc3Br)C(C#N)=C(N)O2)c2ccccc21 |
| InChI | InChI=1S/C22H15BrN4O/c1-27-12-17(13-6-3-5-9-19(13)27)21-15(10-24)20(16(11-25)22(26)28-21)14-7-2-4-8-18(14)23/h2-9,12,20H,26H2,1H3 |
| InChIKey | DHERSJLKNRCLAW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_C(7)', 'substructure': 'N/A'} |
|---|