C25H19F3N2O2 — CID 135651773
5-[(2-methylphenyl)methoxy]-2-[5-phenyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol (PubChem CID 135651773) has the molecular formula C25H19F3N2O2 and a molecular weight of 436.43 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methoxy]-2-[5-phenyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol.
| Compound Name | 5-[(2-methylphenyl)methoxy]-2-[5-phenyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 135651773 |
| Molecular Formula | C25H19F3N2O2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 5-[(2-methylphenyl)methoxy]-2-[5-phenyl-6-(trifluoromethyl)pyrimidin-4-yl]phenol |
| SMILES | Cc1ccccc1COc1ccc(-c2ncnc(C(F)(F)F)c2-c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C25H19F3N2O2/c1-16-7-5-6-10-18(16)14-32-19-11-12-20(21(31)13-19)23-22(17-8-3-2-4-9-17)24(25(26,27)28)30-15-29-23/h2-13,15,31H,14H2,1H3 |
| InChIKey | RGPNHVAUHNXLQM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |