C23H16F3N2O5- — CID 163148942
5-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol (PubChem CID 163148942) has the molecular formula C23H16F3N2O5- and a molecular weight of 457.38 g/mol. Its IUPAC name is 5-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol.
| Compound Name | 5-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 163148942 |
| Molecular Formula | C23H16F3N2O5- |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 5-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-2-[4-phenyl-3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol |
| SMILES | [O-]N(O)c1ccc(COc2ccc(-c3onc(C(F)(F)F)c3-c3ccccc3)c(O)c2)cc1 |
| InChI | InChI=1S/C23H16F3N2O5/c24-23(25,26)22-20(15-4-2-1-3-5-15)21(33-27-22)18-11-10-17(12-19(18)29)32-13-14-6-8-16(9-7-14)28(30)31/h1-12,29-30H,13H2/q-1 |
| InChIKey | JEIOYWPSZJNFJD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|