C18H14N4O2S — CID 135653480
4-(1,3-benzothiazol-2-yl)-1-[(E)-(3-hydroxyphenyl)methylideneamino]-5-imino-2H-pyrrol-3-ol (PubChem CID 135653480) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1-[(E)-(3-hydroxyphenyl)methylideneamino]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1-[(E)-(3-hydroxyphenyl)methylideneamino]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135653480 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1-[(E)-(3-hydroxyphenyl)methylideneamino]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3s2)=C(O)CN1/N=C/c1cccc(O)c1 |
| InChI | InChI=1S/C18H14N4O2S/c19-17-16(18-21-13-6-1-2-7-15(13)25-18)14(24)10-22(17)20-9-11-4-3-5-12(23)8-11/h1-9,19,23-24H,10H2/b19-17-,20-9+ |
| InChIKey | DLTOLMPPPPBMLW-RZWFVBBUSA-N |
| XLogP | 3.60 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|