C19H18BrN5O2 — CID 135660831
7-(5-bromofuran-2-yl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660831) has the molecular formula C19H18BrN5O2 and a molecular weight of 428.29 g/mol. Its IUPAC name is 7-(5-bromofuran-2-yl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(5-bromofuran-2-yl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660831 |
| Molecular Formula | C19H18BrN5O2 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 7-(5-bromofuran-2-yl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2ccc(Br)o2)n2ncnc2N1 |
| InChI | InChI=1S/C19H18BrN5O2/c1-10-5-4-6-13(11(10)2)24-18(26)16-12(3)23-19-21-9-22-25(19)17(16)14-7-8-15(20)27-14/h4-9,17H,1-3H3,(H,24,26)(H,21,22,23) |
| InChIKey | OOAIDLSVHZCVTE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |