C23H22N6O — CID 135955062
(7S)-N-(2,3-dimethylphenyl)-7-(1H-indol-3-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135955062) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is (7S)-N-(2,3-dimethylphenyl)-7-(1H-indol-3-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-N-(2,3-dimethylphenyl)-7-(1H-indol-3-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135955062 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (7S)-N-(2,3-dimethylphenyl)-7-(1H-indol-3-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)[C@H](c2c[nH]c3ccccc23)n2ncnc2N1 |
| InChI | InChI=1S/C23H22N6O/c1-13-7-6-10-18(14(13)2)28-22(30)20-15(3)27-23-25-12-26-29(23)21(20)17-11-24-19-9-5-4-8-16(17)19/h4-12,21,24H,1-3H3,(H,28,30)(H,25,26,27)/t21-/m0/s1 |
| InChIKey | ILNFEAOIYCZNNE-NRFANRHFSA-N |
| XLogP | 4.30 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |