C21H20ClN5O — CID 135662905
7-(3-chlorophenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662905) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-chlorophenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662905 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 7-(3-chlorophenyl)-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2cccc(Cl)c2)n2ncnc2N1 |
| InChI | InChI=1S/C21H20ClN5O/c1-12-6-4-9-17(13(12)2)26-20(28)18-14(3)25-21-23-11-24-27(21)19(18)15-7-5-8-16(22)10-15/h4-11,19H,1-3H3,(H,26,28)(H,23,24,25) |
| InChIKey | DDCJRYWBUQOPOZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |