C30H39N5O3S — CID 135660900
N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(3-methylbutoxy)phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660900) has the molecular formula C30H39N5O3S and a molecular weight of 549.74 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(3-methylbutoxy)phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(3-methylbutoxy)phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660900 |
| Molecular Formula | C30H39N5O3S |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(3-methylbutoxy)phenyl]-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OCCC(C)C)c(OC)c1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C30H39N5O3S/c1-8-16-39-30-33-29-31-21(6)26(28(36)32-23-11-9-10-19(4)20(23)5)27(35(29)34-30)22-12-13-24(25(17-22)37-7)38-15-14-18(2)3/h9-13,17-18,27H,8,14-16H2,1-7H3,(H,32,36)(H,31,33,34) |
| InChIKey | OFNAEAMDKXVYNC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |