C25H28N6O4S — CID 135662824
N-(2,3-dimethylphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662824) has the molecular formula C25H28N6O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662824 |
| Molecular Formula | C25H28N6O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-2-propylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OC)c([N+](=O)[O-])c1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C25H28N6O4S/c1-6-12-36-25-28-24-26-16(4)21(23(32)27-18-9-7-8-14(2)15(18)3)22(30(24)29-25)17-10-11-20(35-5)19(13-17)31(33)34/h7-11,13,22H,6,12H2,1-5H3,(H,27,32)(H,26,28,29) |
| InChIKey | KZFNXALALXVNRI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|