C26H30N6O5S — CID 135662826
2-butylsulfanyl-N-(2-ethoxyphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662826) has the molecular formula C26H30N6O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(2-ethoxyphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-butylsulfanyl-N-(2-ethoxyphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662826 |
| Molecular Formula | C26H30N6O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2-butylsulfanyl-N-(2-ethoxyphenyl)-7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(OC)c([N+](=O)[O-])c1)C(C(=O)Nc1ccccc1OCC)=C(C)N2 |
| InChI | InChI=1S/C26H30N6O5S/c1-5-7-14-38-26-29-25-27-16(3)22(24(33)28-18-10-8-9-11-20(18)37-6-2)23(31(25)30-26)17-12-13-21(36-4)19(15-17)32(34)35/h8-13,15,23H,5-7,14H2,1-4H3,(H,28,33)(H,27,29,30) |
| InChIKey | GGTOTRPRDUJZLW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|