C29H34N6O4S — CID 135662400
N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-7-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135662400) has the molecular formula C29H34N6O4S and a molecular weight of 562.70 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-7-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-7-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135662400 |
| Molecular Formula | C29H34N6O4S |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-ethylsulfanyl-5-methyl-7-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCSc1nc2n(n1)C(c1ccc(OCC(=O)N3CCOCC3)cc1)C(C(=O)Nc1cccc(C)c1C)=C(C)N2 |
| InChI | InChI=1S/C29H34N6O4S/c1-5-40-29-32-28-30-20(4)25(27(37)31-23-8-6-7-18(2)19(23)3)26(35(28)33-29)21-9-11-22(12-10-21)39-17-24(36)34-13-15-38-16-14-34/h6-12,26H,5,13-17H2,1-4H3,(H,31,37)(H,30,32,33) |
| InChIKey | RAYBRXSBLRMCTC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |