C36H35N5O2S — CID 135793208
2-benzylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135793208) has the molecular formula C36H35N5O2S and a molecular weight of 601.78 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135793208 |
| Molecular Formula | C36H35N5O2S |
| Molecular Weight | 601.78 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,3-dimethylphenyl)-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2ccc(OCCc3ccccc3)cc2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C36H35N5O2S/c1-24-11-10-16-31(25(24)2)38-34(42)32-26(3)37-35-39-36(44-23-28-14-8-5-9-15-28)40-41(35)33(32)29-17-19-30(20-18-29)43-22-21-27-12-6-4-7-13-27/h4-20,33H,21-23H2,1-3H3,(H,38,42)(H,37,39,40) |
| InChIKey | AFQQQOCRVXXXDL-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.78 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |