C30H32N6OS — CID 135793222
2-benzylsulfanyl-7-[4-(dimethylamino)phenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135793222) has the molecular formula C30H32N6OS and a molecular weight of 524.69 g/mol. Its IUPAC name is 2-benzylsulfanyl-7-[4-(dimethylamino)phenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzylsulfanyl-7-[4-(dimethylamino)phenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135793222 |
| Molecular Formula | C30H32N6OS |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-benzylsulfanyl-7-[4-(dimethylamino)phenyl]-N-(2,3-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2ccc(N(C)C)cc2)n2nc(SCc3ccccc3)nc2N1 |
| InChI | InChI=1S/C30H32N6OS/c1-19-10-9-13-25(20(19)2)32-28(37)26-21(3)31-29-33-30(38-18-22-11-7-6-8-12-22)34-36(29)27(26)23-14-16-24(17-15-23)35(4)5/h6-17,27H,18H2,1-5H3,(H,32,37)(H,31,33,34) |
| InChIKey | COZWRMRGKJXNTC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |