C36H34FN5O2S — CID 135792671
N-(2,3-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135792671) has the molecular formula C36H34FN5O2S and a molecular weight of 619.77 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135792671 |
| Molecular Formula | C36H34FN5O2S |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-7-[4-(2-phenylethoxy)phenyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2cccc(C)c2C)C(c2ccc(OCCc3ccccc3)cc2)n2nc(SCc3ccccc3F)nc2N1 |
| InChI | InChI=1S/C36H34FN5O2S/c1-23-10-9-15-31(24(23)2)39-34(43)32-25(3)38-35-40-36(45-22-28-13-7-8-14-30(28)37)41-42(35)33(32)27-16-18-29(19-17-27)44-21-20-26-11-5-4-6-12-26/h4-19,33H,20-22H2,1-3H3,(H,39,43)(H,38,40,41) |
| InChIKey | YYNDVIYXKQFSQQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |